
CAS 1190319-32-4
:7-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
Description:
7-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. Its structure allows for potential interactions in biological systems, particularly in enzyme inhibition or as a building block in pharmaceutical synthesis. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the amino group can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular weight, solubility, and stability can vary based on environmental conditions, and it may be sensitive to light or moisture. Overall, 7-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a compound of interest for research in organic synthesis and drug development.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-5-1-2-10-6-4(8(12)13)3-11-7(5)6/h1-3,11H,(H2,9,10)(H,12,13)
InChI key:InChIKey=CSHWUCUTOBUEFD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=C(N)C=CN2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 7-amino-
- 7-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
