CymitQuimica logo

CAS 1190319-35-7

:

3-Nitro-1H-pyrrolo[3,2-b]pyridin-7-amine

Description:
3-Nitro-1H-pyrrolo[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 3-position and an amino group at the 7-position enhances its reactivity and potential for forming various derivatives. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fused ring system can interact with biological targets. Additionally, the nitro group can serve as a handle for further chemical modifications. The compound's molecular framework may also influence its electronic properties, making it a candidate for studies in materials science or organic electronics. As with many nitrogen-containing heterocycles, it may exhibit interesting biological activities, warranting further investigation into its pharmacological potential.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c8-4-1-2-9-7-5(11(12)13)3-10-6(4)7/h1-3,10H,(H2,8,9)
InChI key:InChIKey=TVNAYMAJHJXPED-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=C(N)C=CN2
Synonyms:
  • 3-Nitro-1H-pyrrolo[3,2-b]pyridin-7-amine
  • 1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.