CAS 1190319-38-0
:3-Amino-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
Description:
3-Amino-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features an amino group and a cyano group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals. The cyano group enhances the compound's polarity and can influence its solubility and interaction with biological targets. Additionally, the compound's structural features may impart specific biological activities, making it of interest in drug discovery and development. Its CAS number, 1190319-38-0, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in scientific literature and databases. Overall, 3-Amino-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile represents a significant compound in the field of organic and medicinal chemistry.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-3-5-1-2-11-8-6(10)4-12-7(5)8/h1-2,4,12H,10H2
InChI key:InChIKey=ZXMAQTZRTCYBPE-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(N)=CN2)=NC=C1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-amino-
- 3-Amino-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
