CymitQuimica logo

CAS 1190319-39-1

:

7-Amino-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one

Description:
7-Amino-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. This compound features an amino group at the 7-position and a carbonyl group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through hydrogen bonding and π-π stacking interactions. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and form of the substance. Additionally, the compound's reactivity can be influenced by the presence of functional groups, making it a candidate for further chemical modifications to enhance its efficacy in various applications.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-4-1-2-9-5-3-6(11)10-7(4)5/h1-2H,3H2,(H2,8,9)(H,10,11)
InChI key:InChIKey=ZSCIIFXHBHOEIQ-UHFFFAOYSA-N
SMILES:NC1=C2C(CC(=O)N2)=NC=C1
Synonyms:
  • 7-Amino-1,3-dihydro-2H-pyrrolo[3,2-b]pyridin-2-one
  • 2H-Pyrrolo[3,2-b]pyridin-2-one, 7-amino-1,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.