CymitQuimica logo

CAS 1190319-41-5

:

3-Formyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile

Description:
3-Formyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its unique pyrrole and pyridine ring structure. This compound features a formyl group (-CHO) and a cyano group (-CN) attached to the pyrrolo-pyridine framework, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the formyl group allows for further functionalization, while the cyano group can participate in nucleophilic reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by the presence of substituents and the overall molecular conformation. As with many heterocycles, it may also display interesting electronic properties, which can be explored for applications in materials science and organic electronics.
Formula:C9H5N3O
InChI:InChI=1S/C9H5N3O/c10-3-6-1-2-11-9-7(5-13)4-12-8(6)9/h1-2,4-5,12H
InChI key:InChIKey=CPZVPCBCYHCOCY-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(C(C=O)=CN2)=NC=C1
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-formyl-
  • 3-Formyl-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.