
CAS 1190319-43-7
:3-Nitro-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
Description:
3-Nitro-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts polar characteristics, enhancing its reactivity and potential for hydrogen bonding. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its electronic properties, making it a valuable moiety in medicinal chemistry. This compound is likely to exhibit significant biological activity, which may be explored in pharmaceutical applications, particularly in the development of novel therapeutics. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's stability and solubility can be influenced by the functional groups present, which are critical for its behavior in various chemical environments. Overall, 3-Nitro-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine represents a class of compounds that are important in both synthetic and medicinal chemistry.
Formula:C8H4F3N3O2
InChI:InChI=1S/C8H4F3N3O2/c9-8(10,11)4-1-2-12-7-5(14(15)16)3-13-6(4)7/h1-3,13H
InChI key:InChIKey=QPWOBQJEKXPFST-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(C(N(=O)=O)=CN2)=NC=C1
Synonyms:- 3-Nitro-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
- 1H-Pyrrolo[3,2-b]pyridine, 3-nitro-7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrrolo[3,2-b]pyridine, 3-nitro-7-(trifluoromethyl)-
CAS:Formula:C8H4F3N3O2Molecular weight:231.1315
