CAS 1190319-46-0

2-Methyl-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine

Description:

2-Methyl-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a methyl group at the 2-position and a trifluoromethyl group at the 7-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high lipophilicity due to the trifluoromethyl group, which can influence its biological activity and pharmacokinetics. The trifluoromethyl group is known for enhancing metabolic stability and bioactivity, making this compound of interest in drug development. Additionally, the nitrogen atoms in the heterocyclic rings can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 2-Methyl-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a compound with significant potential in pharmaceutical research, particularly in the development of novel therapeutic agents.

Formula: C₉H₇F₃N₂

InChI: InChI=1S/C9H7F3N2/c1-5-4-7-8(14-5)6(2-3-13-7)9(10,11)12/h2-4,14H,1H3

InChI key: InChIKey=PHVACPFOGGRULK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(C=C(C)N2)=NC=C1

Synonyms:

• 2-Methyl-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 2-methyl-7-(trifluoromethyl)-

1H-Pyrrolo[3,2-b]pyridine, 2-methyl-7-(trifluoromethyl)-

CAS: 1190319-46-0

Formula: C₉H₇F₃N₂

Molecular weight: 200.1605

Ref: IN-DA000HUI