CAS 1190319-50-6

3,4-Dinitro-1H-pyrrolo[2,3-c]pyridine

Description:

3,4-Dinitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of two nitro groups at the 3 and 4 positions enhances its reactivity and polarity, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. This compound typically exhibits a yellow to orange color and is soluble in polar organic solvents. Its structure allows for potential interactions with biological targets, which may lead to pharmacological activity. Additionally, the nitro groups can participate in reduction reactions, making the compound versatile in synthetic pathways. Safety considerations are important, as nitro compounds can be hazardous and may require careful handling and storage. Overall, 3,4-Dinitro-1H-pyrrolo[2,3-c]pyridine is of interest for its chemical reactivity and potential applications in research and development.

Formula: C₇H₄N₄O₄

InChI: InChI=1S/C7H4N4O4/c12-10(13)5-2-8-1-4-7(5)6(3-9-4)11(14)15/h1-3,9H

InChI key: InChIKey=ILGXDYKWAONMAQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CN=CC2N(=O)=O

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 3,4-dinitro-
• 3,4-Dinitro-1H-pyrrolo[2,3-c]pyridine

1H-Pyrrolo[2,3-c]pyridine, 3,4-dinitro-

CAS: 1190319-50-6

Formula: C₇H₄N₄O₄

Molecular weight: 208.1311

Ref: IN-DA000HUF