CymitQuimica logo

CAS 1190319-52-8

:

3-Iodo-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine

Description:
3-Iodo-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both iodine and trifluoromethyl functional groups. The presence of the iodine atom contributes to its potential reactivity, particularly in nucleophilic substitution reactions, while the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is typically used in medicinal chemistry and drug development due to its structural features that can interact with biological targets. Its molecular framework allows for various modifications, making it a versatile building block in the synthesis of more complex molecules. Additionally, the compound's properties, such as solubility and stability, can be influenced by the presence of the trifluoromethyl group, which is known for its electron-withdrawing effects. Overall, 3-Iodo-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is of interest in research fields focused on developing new pharmaceuticals and agrochemicals.
Formula:C8H4F3IN2
InChI:InChI=1S/C8H4F3IN2/c9-8(10,11)4-1-6-7(14-2-4)5(12)3-13-6/h1-3,13H
InChI key:InChIKey=WRXIDCBLQGWXOC-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC(C(F)(F)F)=CN2)NC1
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridine, 3-iodo-6-(trifluoromethyl)-
  • 3-Iodo-6-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.