CAS 1190319-53-9

4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde

Description:

4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine structures, which contribute to its unique chemical properties. The presence of a nitro group (-NO2) at the 4-position and an aldehyde group (-CHO) at the 3-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and electrophilic substitutions. This compound is typically a yellow to orange solid, exhibiting moderate solubility in polar organic solvents. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with nitro-substituted heterocycles. Additionally, the compound may serve as an intermediate in organic synthesis, facilitating the creation of more complex molecules. Safety data should be consulted, as nitro compounds can be hazardous, and appropriate handling and storage conditions are essential to ensure safety in laboratory settings.

Formula: C₈H₅N₃O₃

InChI: InChI=1S/C8H5N3O3/c12-4-5-1-10-6-2-9-3-7(8(5)6)11(13)14/h1-4,10H

InChI key: InChIKey=PJGSHNMOOORQEA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(NC=C2C=O)=CN=C1

Synonyms:

• 4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
• 1H-Pyrrolo[2,3-c]pyridine-3-carboxaldehyde, 4-nitro-

1H-Pyrrolo[2,3-c]pyridine-3-carboxaldehyde, 4-nitro-

CAS: 1190319-53-9

Formula: C₈H₅N₃O₃

Molecular weight: 191.1436

Ref: IN-DA000HVR