CymitQuimica logo

CAS 1190319-61-9

:

Ethyl 2-cyclobutyl-4-oxazolecarboxylate

Description:
Ethyl 2-cyclobutyl-4-oxazolecarboxylate is a chemical compound characterized by its unique structure, which includes an oxazole ring and an ethyl ester functional group. This compound features a cyclobutyl substituent, contributing to its cyclic structure and potentially influencing its reactivity and physical properties. Typically, compounds like this may exhibit moderate polarity due to the presence of both hydrophobic (the cyclobutyl group) and hydrophilic (the carboxylate group) regions. Ethyl 2-cyclobutyl-4-oxazolecarboxylate may be of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. Its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety data and handling precautions should be considered when working with this substance, particularly in laboratory settings.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c1-2-13-10(12)8-6-14-9(11-8)7-4-3-5-7/h6-7H,2-5H2,1H3
InChI key:InChIKey=DVTBGTTXQPVITL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(OC1)C2CCC2
Synonyms:
  • 4-Oxazolecarboxylic acid, 2-cyclobutyl-, ethyl ester
  • Ethyl 2-cyclobutyl-4-oxazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.