CymitQuimica logo

CAS 1190319-69-7

:

3-Chloro-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one

Description:
3-Chloro-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a chlorine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a solid state at room temperature and may have moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in drug discovery and development. The compound's properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), would be essential for identifying and characterizing it in laboratory settings. Additionally, the presence of the carbonyl group in the structure may influence its reactivity, allowing for various chemical transformations. Overall, 3-Chloro-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one represents a valuable compound for further research in organic synthesis and pharmacology.
Formula:C7H5ClN2O
InChI:InChI=1S/C7H5ClN2O/c8-5-3-9-6-1-7(11)10-2-4(5)6/h1-3,9H,(H,10,11)
InChI key:InChIKey=GKFJAYGYDGEUBU-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=CC(=O)NC2
Synonyms:
  • 3-Chloro-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one
  • 6H-Pyrrolo[3,2-c]pyridin-6-one, 3-chloro-1,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.