CAS 1190319-82-4

Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Description:

Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a bromine atom at the 4-position of the pyridine ring introduces notable electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl ester functional group at the 3-position enhances its reactivity and solubility in organic solvents, facilitating its use in synthetic applications. This compound is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anticancer properties, stemming from the structural features that allow for interaction with biological targets. Additionally, its unique structure may contribute to its role in the development of novel pharmaceuticals. As with many brominated compounds, care should be taken regarding its handling and disposal due to potential environmental and health impacts.

Formula: C₉H₇BrN₂O₂

InChI: InChI=1S/C9H7BrN2O2/c1-14-9(13)5-4-12-8-7(5)6(10)2-3-11-8/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=CPNMUJAOYRRWCQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NC1)=NC=CC2Br

Synonyms:

• Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate
• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-bromo-, methyl ester

1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-bromo-, methyl ester

CAS: 1190319-82-4

Formula: C₉H₇BrN₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 255.0681

Ref: IN-DA000HV3

Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

CAS: 1190319-82-4

Methyl 4-bromo-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Purity: 96%

Molecular weight: 255.07g/mol

Ref: 54-OR94303

METHYL 4-BROMO-7-AZAINDOLE-3-CARBOXYLATE

CAS: 1190319-82-4

Formula: C₉H₇BrN₂O₂

Purity: 96%

Molecular weight: 255.071

Ref: 10-F502218