CymitQuimica logo

CAS 1190319-83-5

:

4-Methyl-3-nitro-1H-pyrrolo[3,2-c]pyridine

Description:
4-Methyl-3-nitro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole functionalities. This compound features a methyl group and a nitro group, contributing to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the nitro group typically enhances the compound's electrophilic properties, making it a candidate for further chemical modifications. Additionally, the pyrrolo[3,2-c]pyridine framework is known for its biological activity, which may include antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-Methyl-3-nitro-1H-pyrrolo[3,2-c]pyridine represents a versatile structure in organic synthesis and pharmaceutical development, warranting further investigation into its properties and potential applications.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-5-8-6(2-3-9-5)10-4-7(8)11(12)13/h2-4,10H,1H3
InChI key:InChIKey=MMVSWDAPHDUXLF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CC=NC2C
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 4-methyl-3-nitro-
  • 4-Methyl-3-nitro-1H-pyrrolo[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.