CymitQuimica logo

CAS 1190319-88-0

:

3-Amino-1,5-dihydro-4H-pyrrolo[3,2-c]pyridin-4-one

Description:
3-Amino-1,5-dihydro-4H-pyrrolo[3,2-c]pyridin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. This compound features an amino group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, owing to the presence of both nitrogen-containing rings that are often associated with bioactive compounds. Additionally, the compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it a subject of interest in research. However, detailed studies on its pharmacological properties and safety profile would be necessary to fully understand its utility in various applications.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-4-3-10-5-1-2-9-7(11)6(4)5/h1-3,10H,8H2,(H,9,11)
InChI key:InChIKey=LJMLSADCINMVQD-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=CN1)NC=C2N
Synonyms:
  • 3-Amino-1,5-dihydro-4H-pyrrolo[3,2-c]pyridin-4-one
  • 4H-Pyrrolo[3,2-c]pyridin-4-one, 3-amino-1,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.