CymitQuimica logo

CAS 1190319-96-0

:

1,5-Dihydro-3-iodo-4H-pyrrolo[3,2-c]pyridin-4-one

Description:
1,5-Dihydro-3-iodo-4H-pyrrolo[3,2-c]pyridin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of the iodine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a range of chemical properties, including moderate solubility in polar solvents and stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, making it a candidate for further investigation in drug development. The compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the iodine atom. Additionally, the pyrrolo-pyridine framework is known for its role in various pharmacologically active compounds, which may indicate potential therapeutic applications. Overall, 1,5-Dihydro-3-iodo-4H-pyrrolo[3,2-c]pyridin-4-one represents a significant structure in the field of organic and medicinal chemistry, warranting further exploration of its properties and applications.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-4-3-10-5-1-2-9-7(11)6(4)5/h1-3,10H,(H,9,11)
InChI key:InChIKey=NAEZDHOSGZUUPK-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=CN1)NC=C2I
Synonyms:
  • 1,5-Dihydro-3-iodo-4H-pyrrolo[3,2-c]pyridin-4-one
  • 4H-Pyrrolo[3,2-c]pyridin-4-one, 1,5-dihydro-3-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.