CAS 1190320-07-0

3-Chloro-4-fluoro-1H-pyrrolo[3,2-c]pyridine

Description:

3-Chloro-4-fluoro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents at the 3 and 4 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in polar solvents. It may also display interesting biological activity, making it a candidate for pharmaceutical applications. The molecular structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. Additionally, its synthesis may involve standard organic reactions such as halogenation and cyclization, and it can be analyzed using techniques like NMR and mass spectrometry to confirm its identity and purity. Overall, 3-Chloro-4-fluoro-1H-pyrrolo[3,2-c]pyridine is a compound of interest in both synthetic and medicinal chemistry due to its distinctive structure and functional properties.

Formula: C₇H₄ClFN₂

InChI: InChI=1S/C7H4ClFN2/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3,11H

InChI key: InChIKey=RRYUVFHDUCQMKL-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC=N1)NC=C2Cl

Synonyms:

• 3-Chloro-4-fluoro-1H-pyrrolo[3,2-c]pyridine
• 1H-Pyrrolo[3,2-c]pyridine, 3-chloro-4-fluoro-

1H-Pyrrolo[3,2-c]pyridine, 3-chloro-4-fluoro-

CAS: 1190320-07-0

Formula: C₇H₄ClFN₂

Molecular weight: 170.5715

Ref: IN-DA000HVS