CAS 1190320-08-1
:6-Fluoro-4-quinazolinamine
Description:
6-Fluoro-4-quinazolinamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a fluorine atom at the 6-position and an amino group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The fluorine substitution can enhance lipophilicity and metabolic stability, which are desirable traits in drug design. Additionally, 6-Fluoro-4-quinazolinamine may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in organic synthesis. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H6FN3
InChI:InChI=1S/C8H6FN3/c9-5-1-2-7-6(3-5)8(10)12-4-11-7/h1-4H,(H2,10,11,12)
InChI key:InChIKey=ARIXAZJLBIBWSR-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC(F)=C2)N=CN1
Synonyms:- 4-Quinazolinamine, 6-fluoro-
- 6-Fluoro-4-quinazolinamine
- 6-fluoroquinazolin-4-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-Fluoroquinazolin-4-amine
CAS:Formula:C8H6FN3Purity:95%Color and Shape:SolidMolecular weight:163.15174-Amino-6-fluoroquinazoline
CAS:4-Amino-6-fluoroquinazoline (4AFQ) is a protease inhibitor that has been shown to be effective in treating ulcerative colitis. It inhibits the activity of the human neutrophil elastase and cathepsin G, which are enzymes that degrade proteins and are involved in the inflammatory response. 4AFQ has also been shown to have antiatherogenic effects, inhibiting lipid uptake in macrophages and reducing fatty acid synthesis. This drug also induces apoptosis of monocytes, which reduces inflammation by decreasing cytokine production. 4AFQ is used as a probiotic agent for treatment of bacterial infections or as an additive to food products. 4AFQ can also be used as an adjuvant therapy for cancer treatments because it increases the effectiveness of chemotherapy drugs such as cisplatin and paclitaxel. This drug's water-soluble nature allows it to penetrate cell membranes more easily than other drugs with similarFormula:C8H6FN3Purity:Min. 95%Color and Shape:PowderMolecular weight:163.15 g/mol


