CAS 1190320-10-5: 1H-Pyrrolo[2,3-c]pyridin-4-amine

Description: 1H-Pyrrolo[2,3-c]pyridin-4-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a basic nitrogen atom in its structure, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its molecular framework allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the amino group at the 4-position enhances its reactivity and solubility in polar solvents. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings, which can influence its behavior in electronic applications. Overall, 1H-Pyrrolo[2,3-c]pyridin-4-amine is a versatile compound with potential utility in various fields, including drug discovery and materials science.

Formula: C₇H₇N₃

InChI: InChI=1S/C7H7N3/c8-6-3-9-4-7-5(6)1-2-10-7/h1-4,10H,8H2

InChI key: InChIKey=FSUXDDPRSWEDMB-UHFFFAOYSA-N

SMILES: N=1C=C(N)C=2C=CNC2C1

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridin-4-amine

1H-Pyrrolo[2,3-c]pyridin-4-aMine

CAS: 1190320-10-5

• Formula: C₇H₇N₃
• Purity: 95%
• Molecular weight: 133.1506

1H-Pyrrolo[2,3-c]pyridin-4-amine

CAS: 1190320-10-5

• Purity: 95+%
• Molecular weight: 133.1540069580078

1H-Pyrrolo[2,3-c]pyridin-4-amine

CAS: 1190320-10-5

Versatile small molecule scaffold

• Formula: C₇H₇N₃
• Purity: Min. 95%
• Molecular weight: 133.15 g/mol