CymitQuimica logo

CAS 1190320-15-0

:

6-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:
6-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 6-position of the pyrrole ring and an amino group at the 3-position of the pyridine ring, influencing its reactivity and potential biological activity. The presence of these functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Its structural configuration allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's solubility and stability can be influenced by the presence of the methyl and amino groups, which may affect its interaction with biological systems. Overall, 6-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine represents a class of compounds that are of interest for further research in drug discovery and development.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-2-8-6(3-10-5)7(9)4-11-8/h2-4,11H,9H2,1H3
InChI key:InChIKey=MNTCBIKDERKVMW-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(C)=NC2
Synonyms:
  • 6-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine
  • 1H-Pyrrolo[3,2-c]pyridin-3-amine, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.