CymitQuimica logo

CAS 1190320-18-3

:

4-Quinolinemethanamine, 8-bromo-, 2,2,2-trifluoroacetate (1:1)

Description:
4-Quinolinemethanamine, 8-bromo-, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its unique structure, which includes a quinoline ring system and a trifluoroacetate moiety. The presence of the bromine atom at the 8-position of the quinoline enhances its reactivity and potential biological activity. This compound is typically used in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. The trifluoroacetate group contributes to the compound's solubility and stability in various solvents, making it useful in laboratory applications. Additionally, the compound's molecular interactions can be influenced by the electron-withdrawing nature of the trifluoroacetate and the bromine substituent, which may affect its pharmacological properties. As with many quinoline derivatives, it may exhibit a range of biological activities, including antimicrobial or antitumor effects, although specific biological data would depend on further empirical studies. Safety and handling precautions should be observed due to the presence of bromine and the potential toxicity of the compound.
Formula:C10H9BrN2·C2HF3O2
InChI:InChI=1S/C10H9BrN2.C2HF3O2/c11-9-3-1-2-8-7(6-12)4-5-13-10(8)9;3-2(4,5)1(6)7/h1-5H,6,12H2;(H,6,7)
InChI key:InChIKey=FZNGTRGKARISHK-UHFFFAOYSA-N
SMILES:C(N)C=1C2=C(C(Br)=CC=C2)N=CC1.C(C(O)=O)(F)(F)F
Synonyms:
  • 4-Quinolinemethanamine, 8-bromo-, 2,2,2-trifluoroacetate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.