
CAS 1190320-19-4
:3-Formyl-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile
Description:
3-Formyl-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its unique pyrrole and pyridine ring structure. This compound features a formyl group (-CHO) and a cyano group (-CN) attached to the pyrrolo-pyridine framework, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of these functional groups suggests that it may participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The compound's structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, its heterocyclic nature may impart specific electronic properties, influencing its behavior in chemical reactions and interactions with other molecules. As with many heterocycles, the compound may exhibit interesting physical properties, including solubility in organic solvents and potential fluorescence, which can be useful in various analytical applications. Overall, 3-Formyl-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile represents a versatile scaffold for further chemical exploration and application.
Formula:C9H5N3O
InChI:InChI=1S/C9H5N3O/c10-1-6-2-11-4-8-9(6)7(5-13)3-12-8/h2-5,12H
InChI key:InChIKey=FEDIFWNTJWSAMI-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CN=CC2C#N
Synonyms:- 3-Formyl-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile
- 1H-Pyrrolo[2,3-c]pyridine-4-carbonitrile, 3-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
