
CAS 1190320-26-3
:2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile
Description:
2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine functionalities. This compound features a carbonitrile group, contributing to its potential reactivity and applications in organic synthesis. The presence of the carbonyl group (2-oxo) enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic additions. Its molecular structure suggests potential biological activity, which may be explored in medicinal chemistry. The compound is typically synthesized through multi-step organic reactions, and its properties may include moderate solubility in polar solvents, stability under standard laboratory conditions, and potential for further functionalization. As with many heterocycles, it may exhibit interesting electronic properties due to the conjugation within its ring system. Overall, 2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile represents a valuable scaffold in the development of pharmaceuticals and agrochemicals.
Formula:C8H5N3O
InChI:InChI=1S/C8H5N3O/c9-2-5-3-10-4-7-6(5)1-8(12)11-7/h3-4H,1H2,(H,11,12)
InChI key:InChIKey=DPWJZAMAZSWBMR-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(NC(=O)C2)=CN=C1
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine-4-carbonitrile, 2,3-dihydro-2-oxo-
- 2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-c]pyridine-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.