CAS 1190320-30-9

3-Iodo-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid

Description:

3-Iodo-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its unique pyrrole and pyridine ring structure, which contributes to its potential biological activity. The presence of the iodine atom enhances its reactivity and may influence its pharmacological properties. This compound features a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its practical use in research and industry. Additionally, the presence of halogens like iodine often affects the compound's electronic properties, potentially leading to interesting interactions in biological systems. Overall, 3-Iodo-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid represents a valuable scaffold for further exploration in chemical synthesis and drug discovery.

Formula: C₈H₅IN₂O₂

InChI: InChI=1S/C8H5IN2O2/c9-5-2-11-6-3-10-1-4(7(5)6)8(12)13/h1-3,11H,(H,12,13)

InChI key: InChIKey=XPUBGZVJRUPPKC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=CN=C1)NC=C2I

Synonyms:

• 3-Iodo-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid
• 1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid, 3-iodo-

1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid, 3-iodo-

CAS: 1190320-30-9

Formula: C₈H₅IN₂O₂

Molecular weight: 288.042

Ref: IN-DA000HWK