CAS 1190320-32-1

3-Nitro-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid

Description:

3-Nitro-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a nitro group (-NO2) and a carboxylic acid group (-COOH) enhances its reactivity and solubility in polar solvents. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fused ring system can influence biological activity. Additionally, the nitro group may serve as a site for further functionalization, making it a versatile intermediate in organic synthesis. The compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application in research and industry.

Formula: C₈H₅N₃O₄

InChI: InChI=1S/C8H5N3O4/c12-8(13)4-1-9-2-5-7(4)6(3-10-5)11(14)15/h1-3,10H,(H,12,13)

InChI key: InChIKey=MRRZGWZXDDHCJK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CN=CC2C(O)=O

Synonyms:

• 3-Nitro-1H-pyrrolo[2,3-c]pyridine-4-carboxylic acid
• 1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid, 3-nitro-

1H-Pyrrolo[2,3-c]pyridine-4-carboxylic acid, 3-nitro-

CAS: 1190320-32-1

Formula: C₈H₅N₃O₄

Molecular weight: 207.143

Ref: IN-DA000HWI