
CAS 1190320-37-6
:3-Bromo-6-fluoro-1H-pyrrolo[3,2-b]pyridine
Description:
3-Bromo-6-fluoro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and fluorine substituents at specific positions on the aromatic system enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in various solvents. Additionally, the structural arrangement allows for potential interactions with biological targets, making it of interest in drug discovery. Its molecular structure can lead to interesting electronic properties, which may be exploited in the development of organic electronic materials. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, 3-Bromo-6-fluoro-1H-pyrrolo[3,2-b]pyridine represents a versatile scaffold for further chemical modifications and applications in various fields of research.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-5-3-10-6-1-4(9)2-11-7(5)6/h1-3,10H
InChI key:InChIKey=MTPXSCMRHTVSQA-UHFFFAOYSA-N
SMILES:BrC=1C=2C(NC1)=CC(F)=CN2
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-6-fluoro-
- 3-Bromo-6-fluoro-1H-pyrrolo[3,2-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
