CAS 1190320-39-8

6-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:

6-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring. The presence of a chlorine atom at the 6-position and an amino group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been explored for their therapeutic properties. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent, which may affect its interactions in biological systems. Additionally, the presence of nitrogen atoms in the rings can participate in hydrogen bonding, further influencing its chemical behavior and interactions. Overall, 6-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine is of interest for its structural features and potential applications in drug discovery.

Formula: C₇H₆ClN₃

InChI: InChI=1S/C7H6ClN3/c8-7-1-6-4(2-11-7)5(9)3-10-6/h1-3,10H,9H2

InChI key: InChIKey=DPLYQVGPHWROMB-UHFFFAOYSA-N

SMILES: NC=1C=2C(NC1)=CC(Cl)=NC2

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridin-3-amine, 6-chloro-
• 6-Chloro-1H-pyrrolo[3,2-c]pyridin-3-amine

1H-Pyrrolo[3,2-c]pyridin-3-amine, 6-chloro-

CAS: 1190320-39-8

Formula: C₇H₆ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA000HXQ