
CAS 1190320-43-4
:4-Fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
Description:
4-Fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a fluorine atom at the 4-position of the pyrrole ring enhances its reactivity and can influence its electronic properties, making it a valuable intermediate in medicinal chemistry and material science. The aldehyde functional group at the 3-position is reactive, allowing for various chemical transformations, such as condensation reactions and nucleophilic additions. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activity. Its molecular structure suggests it may exhibit interesting interactions with biological targets, making it a subject of research in drug discovery. Additionally, the compound's stability and solubility characteristics are influenced by the presence of the fluorine atom and the aldehyde group, which can affect its behavior in different solvents and environments. Overall, 4-Fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde is a versatile compound with significant implications in various fields of chemistry.
Formula:C8H5FN2O
InChI:InChI=1S/C8H5FN2O/c9-6-2-10-3-7-8(6)5(4-12)1-11-7/h1-4,11H
InChI key:InChIKey=PQSDMTIGORRPOD-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CN=CC2F
Synonyms:- 4-Fluoro-1H-pyrrolo[2,3-c]pyridine-3-carboxaldehyde
- 1H-Pyrrolo[2,3-c]pyridine-3-carboxaldehyde, 4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
