CAS 1190320-45-6

3-Bromo-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine

Description:

3-Bromo-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both bromine and trifluoromethyl functional groups. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, often increasing the potency of pharmaceuticals. This compound is typically used in medicinal chemistry and material science due to its interesting electronic properties and potential applications in drug development. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in research focused on developing new therapeutic agents. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and conditions, which are important factors to consider in experimental applications.

Formula: C₈H₄BrF₃N₂

InChI: InChI=1S/C8H4BrF3N2/c9-5-3-14-6-4(8(10,11)12)1-2-13-7(5)6/h1-3,14H

InChI key: InChIKey=QHQDQAVFGCCGTI-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(C(Br)=CN2)=NC=C1

Synonyms:

• 3-Bromo-7-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-(trifluoromethyl)-

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-(trifluoromethyl)-

CAS: 1190320-45-6

Formula: C₈H₄BrF₃N₂

Molecular weight: 265.03

Ref: IN-DA000HXK