CAS 1190320-63-8

3-Chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine

Description:

3-Chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents at the 3 and 4 positions, respectively, enhances its reactivity and potential for various applications in medicinal chemistry and material science. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in polar solvents. Its structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound may display interesting electronic properties due to the conjugated system formed by the fused rings, which can affect its behavior in electronic applications. As with many halogenated compounds, it is essential to handle it with care, considering potential environmental and health impacts. Overall, 3-Chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine represents a valuable scaffold in the development of new chemical entities.

Formula: C₇H₄ClFN₂

InChI: InChI=1S/C7H4ClFN2/c8-4-1-11-6-3-10-2-5(9)7(4)6/h1-3,11H

InChI key: InChIKey=MVKVOKVIGCGKMW-UHFFFAOYSA-N

SMILES: FC1=C2C(=CN=C1)NC=C2Cl

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridine, 3-chloro-4-fluoro-
• 3-Chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine

1H-Pyrrolo[2,3-c]pyridine, 3-chloro-4-fluoro-

CAS: 1190320-63-8

Formula: C₇H₄ClFN₂

Molecular weight: 170.5715

Ref: IN-DA000HXC