CAS 1190320-77-4

4-Fluoro-5,7-dimethyl-1H-indole

Description:

4-Fluoro-5,7-dimethyl-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and two methyl groups at the 5 and 7 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic indole framework. The fluorine substitution can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other molecules. Indoles are known for their presence in various natural products and pharmaceuticals, making derivatives like 4-Fluoro-5,7-dimethyl-1H-indole of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence, which can be useful in various analytical applications. Its specific applications and reactivity would depend on the context of its use, including potential roles in drug development or as a building block in organic synthesis.

Formula: C₁₀H₁₀FN

InChI: InChI=1S/C10H10FN/c1-6-5-7(2)10-8(9(6)11)3-4-12-10/h3-5,12H,1-2H3

InChI key: InChIKey=DIPXPUYTDGUVAY-UHFFFAOYSA-N

SMILES: FC1=C2C(=C(C)C=C1C)NC=C2

Synonyms:

• 1H-Indole, 4-fluoro-5,7-dimethyl-
• 4-Fluoro-5,7-dimethyl-1H-indole

1H-Indole, 4-fluoro-5,7-dimethyl-

CAS: 1190320-77-4

Formula: C₁₀H₁₀FN

Molecular weight: 163.1915

Ref: IN-DA000HYI