CAS 1190320-78-5

Methyl 6-bromo-2-chloro-4-benzothiazolecarboxylate

Description:

Methyl 6-bromo-2-chloro-4-benzothiazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring, a carboxylate group, and halogen substituents. The presence of bromine and chlorine atoms contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The benzothiazole moiety is known for its biological activity, which may include antimicrobial or antifungal properties. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 6-bromo-2-chloro-4-benzothiazolecarboxylate is a compound of interest in both research and industrial applications due to its structural features and potential reactivity.

Formula: C₉H₅BrClNO₂S

InChI: InChI=1S/C9H5BrClNO2S/c1-14-8(13)5-2-4(10)3-6-7(5)12-9(11)15-6/h2-3H,1H3

InChI key: InChIKey=CXOKUPPASJEAQR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(SC(Cl)=N2)=CC(Br)=C1

4-Benzothiazolecarboxylic acid, 6-bromo-2-chloro-, methyl ester

CAS: 1190320-78-5

Formula: C₉H₅BrClNO₂S

Molecular weight: 306.5635

Ref: IN-DA000HYH