CymitQuimica logo

CAS 1190320-80-9

:

3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:
3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both bromine and trifluoromethyl functional groups. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its electronic properties. The trifluoromethyl group is known for its strong electron-withdrawing effects, which can significantly alter the compound's chemical behavior, making it useful in various synthetic applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine ring, which is often associated with biological activity. Additionally, the compound's unique characteristics may allow it to serve as a building block in the synthesis of more complex molecules or as a ligand in coordination chemistry. Safety and handling precautions should be observed due to the presence of halogens and the potential for toxicity.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-5-3-13-7-4(5)1-2-6(14-7)8(10,11)12/h1-3H,(H,13,14)
InChI key:InChIKey=YENKHDCSQLSLKJ-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=NC(C(F)(F)F)=CC2)NC1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-6-(trifluoromethyl)-
  • 3-Bromo-6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.