CAS 1190320-85-4
:4,6-Difluorobenzothiazole
Description:
4,6-Difluorobenzothiazole is a heterocyclic organic compound characterized by the presence of both fluorine atoms and a benzothiazole moiety. This compound features a benzene ring fused to a thiazole ring, which contains sulfur and nitrogen atoms. The difluorination occurs at the 4 and 6 positions of the benzothiazole structure, influencing its chemical reactivity and physical properties. Typically, compounds like 4,6-difluorobenzothiazole exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the presence of functional groups and the electronic effects of the fluorine substituents. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its potential biological activity and ability to participate in further chemical transformations. Additionally, its unique structure may impart specific properties such as solubility and melting point, which are crucial for its practical applications. Safety and handling considerations should be observed, as with any chemical substance, to mitigate potential hazards.
Formula:C7H3F2NS
InChI:InChI=1S/C7H3F2NS/c8-4-1-5(9)7-6(2-4)11-3-10-7/h1-3H
InChI key:InChIKey=ULZYBRSOSIIFAE-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(F)=C1)SC=N2
Synonyms:- Benzothiazole, 4,6-difluoro-
- 4,6-Difluorobenzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
