CAS 1190320-89-8

6-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde

Description:

6-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates a trifluoromethyl group and an aldehyde functional group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, making it suitable for various synthetic applications. Its aldehyde functionality allows for further chemical modifications, such as condensation reactions or nucleophilic additions. The compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Additionally, its unique electronic properties, imparted by the trifluoromethyl group, may contribute to its reactivity in various chemical reactions. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit specific toxicological profiles.

Formula: C₉H₅F₃N₂O

InChI: InChI=1S/C9H5F3N2O/c10-9(11,12)7-2-1-6-5(4-15)3-13-8(6)14-7/h1-4H,(H,13,14)

InChI key: InChIKey=WGHNSQOZDLSFIL-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=NC(C(F)(F)F)=CC2)NC1

Synonyms:

• 6-(Trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
• 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 6-(trifluoromethyl)-