
CAS 1190321-00-6
:3-Iodo-5-nitro-1H-pyrrolo[2,3-b]pyridine
Description:
3-Iodo-5-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes both pyridine and pyrrole moieties. The presence of an iodine atom at the 3-position and a nitro group at the 5-position contributes to its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its non-polar characteristics. Its molecular structure allows for various substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. The nitro group can serve as a site for reduction reactions, while the iodine atom can participate in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest for pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Iodo-5-nitro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in chemical synthesis and potential therapeutic applications.
Formula:C7H4IN3O2
InChI:InChI=1S/C7H4IN3O2/c8-6-3-10-7-5(6)1-4(2-9-7)11(12)13/h1-3H,(H,9,10)
InChI key:InChIKey=CYYGPQUFQCENGI-UHFFFAOYSA-N
SMILES:IC=1C=2C(=NC=C(N(=O)=O)C2)NC1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-5-nitro-
- 3-Iodo-5-nitro-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
