CAS 1190321-03-9
:3,7-Diiodo-6-methoxy-1H-indazole
Description:
3,7-Diiodo-6-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two iodine atoms at the 3 and 7 positions contributes to its halogenated nature, which can significantly influence its reactivity and biological activity. The methoxy group at the 6 position enhances its solubility and can affect its electronic properties. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its iodine substituents can also impart unique characteristics such as increased lipophilicity and potential for interactions with biological targets. The compound's molecular structure suggests potential applications in drug development, particularly in areas where halogenated compounds are known to exhibit enhanced activity. As with many indazole derivatives, it may also be investigated for its role in various chemical reactions or as a precursor in synthetic pathways. Safety and handling precautions should be observed due to the presence of iodine, which can be hazardous in certain forms.
Formula:C8H6I2N2O
InChI:InChI=1S/C8H6I2N2O/c1-13-5-3-2-4-7(6(5)9)11-12-8(4)10/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=PTTVVOHZSDDNPP-UHFFFAOYSA-N
SMILES:IC1=C2C(C(I)=NN2)=CC=C1OC
Synonyms:- 3,7-Diiodo-6-methoxy-1H-indazole
- 1H-Indazole, 3,7-diiodo-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
