
CAS 1190321-05-1
:7-Fluoro-3-iodo-1H-pyrrolo[2,3-c]pyridine
Description:
7-Fluoro-3-iodo-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both fluorine and iodine substituents. The presence of the fluorine atom at the 7-position and the iodine atom at the 3-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological interactions. Additionally, the compound may exhibit interesting electronic properties owing to the conjugated system within the pyrrolopyridine framework. As with many halogenated compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its chemical behavior, reactivity, and potential applications in various fields.
Formula:C7H4FIN2
InChI:InChI=1S/C7H4FIN2/c8-7-6-4(1-2-10-7)5(9)3-11-6/h1-3,11H
InChI key:InChIKey=OPVYPHKWNMXGSN-UHFFFAOYSA-N
SMILES:FC1=C2C(C(I)=CN2)=CC=N1
Synonyms:- 7-Fluoro-3-iodo-1H-pyrrolo[2,3-c]pyridine
- 1H-Pyrrolo[2,3-c]pyridine, 7-fluoro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
