CAS 1190321-09-5

3-Bromo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

3-Bromo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrrole functionalities. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 4-position further influences its electronic properties and steric hindrance. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Additionally, the compound's solubility and stability can be affected by the substituents on the aromatic rings, which is crucial for its application in synthesis and formulation. Overall, 3-Bromo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold for further chemical modifications and research into its pharmacological properties.

Formula: C₉H₉BrN₂O

InChI: InChI=1S/C9H9BrN2O/c1-5-7(13-2)4-12-9-8(5)6(10)3-11-9/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=QORQGYYSFCPCGR-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC=C1OC)NC=C2Br

Synonyms:

• 3-Bromo-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 3-bromo-5-methoxy-4-methyl-

1H-Pyrrolo[2,3-b]pyridine, 3-bromo-5-methoxy-4-methyl-

CAS: 1190321-09-5

Formula: C₉H₉BrN₂O

Molecular weight: 241.0846

Ref: IN-DA000HZ8