CAS 1190321-11-9

3-Formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

Description:

3-Formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a formyl group (-CHO) and a carboxylic acid group (-COOH), making it a versatile building block in organic synthesis. The presence of these functional groups allows for various chemical reactions, including condensation and esterification. The structure of this compound suggests potential biological activity, which may be explored in medicinal chemistry. Additionally, its heterocyclic nature may impart specific electronic properties, influencing its reactivity and interactions with other molecules. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while its aromatic rings may provide stability and contribute to its overall hydrophobic character. As with many heterocycles, it may exhibit interesting fluorescence or photochemical properties, making it a candidate for applications in materials science or pharmaceuticals.

Formula: C₉H₆N₂O₃

InChI: InChI=1S/C9H6N2O3/c12-4-5-3-11-8-7(5)6(9(13)14)1-2-10-8/h1-4H,(H,10,11)(H,13,14)

InChI key: InChIKey=VGKXTCSGDWIWKB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(NC=C2C=O)=NC=C1

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 3-formyl-
• 3-Formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

3-Formyl-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

CAS: 1190321-11-9

Formula: C₉H₆N₂O₃

Molecular weight: 190.1555

Ref: IN-DA000HZ7

3-Formyl-1h-pyrrolo[2,3-b]pyridine-4-carboxylic acid

CAS: 1190321-11-9

Purity: 95+%

Molecular weight: 190.1580048

Ref: 10-F640199

3-Formyl-7-azaindole-4-carboxylic acid

CAS: 1190321-11-9

Versatile small molecule scaffold

Formula: C₉H₆N₂O₃

Purity: Min. 95%

Molecular weight: 190.16 g/mol

Ref: 3D-QXB32111