
CAS 1190321-12-0
:6-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine
Description:
6-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position and a nitro group at the 3-position enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure allows for various substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. The nitro group can participate in reduction reactions, while the bromine can serve as a leaving group in nucleophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in drug discovery. Its molecular structure and functional groups suggest potential interactions with biological targets, which could be explored in pharmacological studies. Overall, 6-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-6-2-1-4-5(11(12)13)3-9-7(4)10-6/h1-3H,(H,9,10)
InChI key:InChIKey=LVHQFOBVLMDZBH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=NC(Br)=CC2
Synonyms:- 6-Bromo-3-nitro-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
