CymitQuimica logo

CAS 1190321-31-3

:

6-Bromo-3-chloro-1H-pyrrolo[2,3-b]pyridine

Description:
6-Bromo-3-chloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high solubility in organic solvents, making it suitable for various synthetic reactions. Its structure suggests potential biological activity, particularly in the development of pharmaceuticals, as similar compounds have been investigated for their roles as kinase inhibitors and in other therapeutic areas. The compound's molecular framework allows for diverse functionalization, which can lead to the synthesis of derivatives with tailored properties. Additionally, its stability under standard laboratory conditions makes it a valuable intermediate in organic synthesis. Overall, 6-Bromo-3-chloro-1H-pyrrolo[2,3-b]pyridine is a significant compound in the field of organic chemistry, with implications for both research and industrial applications.
Formula:C7H4BrClN2
InChI:InChI=1S/C7H4BrClN2/c8-6-2-1-4-5(9)3-10-7(4)11-6/h1-3H,(H,10,11)
InChI key:InChIKey=JSXYRZQDDWATNS-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=NC(Br)=CC2
Synonyms:
  • 6-Bromo-3-chloro-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 6-bromo-3-chloro-
  • 6-BroMo-3-Chloro-7-azaindole
Found 4 products.