CymitQuimica logo

CAS 1190321-57-3

:

Methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate

Description:
Methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a fluorine atom at the 6-position and a carboxylate ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate group. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. Methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its identity and purity. Overall, this compound represents a valuable scaffold for further research and development in various chemical applications.
Formula:C9H7FN2O2
InChI:InChI=1S/C9H7FN2O2/c1-14-9(13)6-4-7(10)12-8-5(6)2-3-11-8/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=RNGMIGNBVNPKAS-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(=NC(F)=C1)NC=C2
Synonyms:
  • Methyl 6-fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
  • 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 6-fluoro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.