CAS 1190321-58-4
:4-Chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine
Description:
4-Chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a chlorine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. The chlorine substituent can influence the compound's electronic properties and steric hindrance, affecting its interaction with biological targets. Additionally, the methoxy group can enhance lipophilicity, potentially improving membrane permeability. As with many heterocycles, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c1-12-7-4-6(9)5-2-3-10-8(5)11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=SWZFPLUXUHUGIV-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(OC)=C1)NC=C2
Synonyms:- 4-Chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine
- 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-6-methoxy-
- 4-Chloro-6-Methoxy-7-azaindole
- 4-fluoro-6-methoxy-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-6-methoxy-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C8H7ClN2OColor and Shape:SolidMolecular weight:182.6070
