
CAS 1190321-60-8
:3-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine
Description:
3-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents at the 3 and 5 positions, respectively, enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. The compound's reactivity can be influenced by the electronegative halogen atoms, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the pyrrolo[2,3-b]pyridine framework may impart specific pharmacological properties, making it a candidate for further investigation in therapeutic applications. Safety and handling precautions should be observed due to the presence of halogenated compounds, which may pose environmental and health risks.
Formula:C7H4ClFN2
InChI:InChI=1S/C7H4ClFN2/c8-6-3-11-7-5(6)1-4(9)2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=SEWNBPNLLPQGMF-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=NC=C(F)C2)NC1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-5-fluoro-
- 3-Chloro-5-fluoro-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
