CAS 1190321-68-6

4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid

Description:

4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a carboxylic acid functional group at the 6-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the electron-withdrawing chlorine atom. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and material science. The carboxylic acid group allows for potential interactions with biological targets, suggesting possible applications in pharmaceuticals. Additionally, its structural features may lead to interesting electronic properties, which could be explored in the development of organic electronic materials. Overall, 4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid is a versatile compound with potential applications in various fields of research.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-5-3-6(8(12)13)11-7-4(5)1-2-10-7/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=YCRQKZFBXVQIDE-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC(C(O)=O)=C1)NC=C2

Synonyms:

• 4-Chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid
• 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 4-chloro-
• 4-Chloro-7-azaindole-6-carboxylic acid

1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 4-chloro-

CAS: 1190321-68-6

Formula: C₈H₅ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 196.5905

Ref: IN-DA000HZR

4-chloro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid

CAS: 1190321-68-6

Formula: C₈H₅ClN₂O₂

Purity: 95.0%

Molecular weight: 196.59

Ref: 10-F516908