CAS 1190321-79-9

Methyl 6-fluoro-4-benzothiazolecarboxylate

Description:

Methyl 6-fluoro-4-benzothiazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole ring fused with a carboxylate group and a fluorine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the electron-withdrawing fluorine atom. The methyl ester functional group contributes to its solubility in organic solvents and may influence its reactivity in various chemical reactions, including esterification and nucleophilic substitution. Methyl 6-fluoro-4-benzothiazolecarboxylate is of interest in medicinal chemistry and material science, where it may serve as a building block for the synthesis of biologically active molecules or functional materials. Its specific applications and behavior in reactions can vary based on the surrounding conditions, such as temperature and solvent choice. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₉H₆FNO₂S

InChI: InChI=1S/C9H6FNO2S/c1-13-9(12)6-2-5(10)3-7-8(6)11-4-14-7/h2-4H,1H3

InChI key: InChIKey=MUIRJVOHAYMGHP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(=CC(F)=C1)SC=N2

Synonyms:

• 6-Fluorobenzothiazole-4-carboxylic acid methyl ester
• Methyl 6-fluoro-4-benzothiazolecarboxylate
• 4-Benzothiazolecarboxylic acid, 6-fluoro-, methyl ester

4-Benzothiazolecarboxylic acid, 6-fluoro-, methyl ester

CAS: 1190321-79-9

Formula: C₉H₆FNO₂S

Molecular weight: 211.2128

Ref: IN-DA000HZG