CAS 1190321-87-9

4-Fluoro-6-methoxy-1H-pyrrolo[2,3-b]pyridine

Description:

4-Fluoro-6-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a fluorine atom at the 4-position and a methoxy group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Additionally, the fluorine atom may enhance the compound's metabolic stability and lipophilicity, making it a candidate for further research in drug discovery. As with many heterocycles, it may also display interesting electronic properties, which can be exploited in various chemical reactions or material science applications. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₈H₇FN₂O

InChI: InChI=1S/C8H7FN2O/c1-12-7-4-6(9)5-2-3-10-8(5)11-7/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=WPXOSPLQDHLVRF-UHFFFAOYSA-N

SMILES: FC1=C2C(=NC(OC)=C1)NC=C2

Synonyms:

• 4-Fluoro-6-methoxy-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 4-fluoro-6-methoxy-

1H-Pyrrolo[2,3-b]pyridine, 4-fluoro-6-methoxy-

CAS: 1190321-87-9

Formula: C₈H₇FN₂O

Molecular weight: 166.1524

Ref: IN-DA000I0M