CAS 1190321-88-0
:4-Amino-6-benzothiazolol
Description:
4-Amino-6-benzothiazolol, identified by its CAS number 1190321-88-0, is a chemical compound that features a benzothiazole core, which is a bicyclic structure composed of a benzene ring fused to a thiazole ring. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the amino group (-NH2) suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the benzothiazole moiety is known for its role in fluorescence and as a building block in the synthesis of dyes and pigments. The compound's solubility can vary depending on the solvent, and it may exhibit specific reactivity patterns due to the functional groups present. Overall, 4-Amino-6-benzothiazolol is of interest in research and development for its potential utility in various chemical applications.
Formula:C7H6N2OS
InChI:InChI=1S/C7H6N2OS/c8-5-1-4(10)2-6-7(5)9-3-11-6/h1-3,10H,8H2
InChI key:InChIKey=KRHHLUPAEWWLRV-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(O)=C1)SC=N2
Synonyms:- 6-Benzothiazolol, 4-amino-
- 4-Amino-6-benzothiazolol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
