CymitQuimica logo

CAS 1190322-08-7

:

3-Iodo-1H-pyrrolo[2,3-b]pyridin-4-amine

Description:
3-Iodo-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of an iodine atom at the 3-position and an amino group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure allows for various interactions, making it a candidate for drug development, particularly in targeting specific biological pathways. The iodine substituent can also facilitate further chemical modifications, enhancing its utility in synthetic chemistry. As with many heterocycles, it may exhibit interesting electronic properties and biological activities, which are often explored in the context of pharmacological research. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and amines.
Formula:C7H6IN3
InChI:InChI=1S/C7H6IN3/c8-4-3-11-7-6(4)5(9)1-2-10-7/h1-3H,(H3,9,10,11)
InChI key:InChIKey=SFPSSODDVODIGF-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1)NC=C2I
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-4-amine, 3-iodo-
  • 3-Iodo-1H-pyrrolo[2,3-b]pyridin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.